About 4-(6-methoxy-3,4-dihydroisoquinolin-1-yl)benzenesulfonamide
4-(6-methoxy-3,4-dihydroisoquinolin-1-yl)benzenesulfonamide (PubChem CID 56928044) has the molecular formula C16H16N2O3S
and a molecular weight of 316.38 g/mol. Its IUPAC name is 4-(6-methoxy-3,4-dihydroisoquinolin-1-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-(6-methoxy-3,4-dihydroisoquinolin-1-yl)benzenesulfonamide |
| PubChem CID | 56928044 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 4-(6-methoxy-3,4-dihydroisoquinolin-1-yl)benzenesulfonamide |
| SMILES | COc1ccc2c(c1)CCN=C2c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H16N2O3S/c1-21-13-4-7-15-12(10-13)8-9-18-16(15)11-2-5-14(6-3-11)22(17,19)20/h2-7,10H,8-9H2,1H3,(H2,17,19,20) |
| InChIKey | RZQVMYVIRNCVDY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(6-methoxy-3,4-dihydroisoquinolin-1-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-methoxy-3,4-dihydroisoquinolin-1-yl)benzenesulfonamide?
The IUPAC name of 4-(6-methoxy-3,4-dihydroisoquinolin-1-yl)benzenesulfonamide (CID 56928044) is 4-(6-methoxy-3,4-dihydroisoquinolin-1-yl)benzenesulfonamide.
What is the SMILES notation for 4-(6-methoxy-3,4-dihydroisoquinolin-1-yl)benzenesulfonamide?
The canonical SMILES for 4-(6-methoxy-3,4-dihydroisoquinolin-1-yl)benzenesulfonamide is COc1ccc2c(c1)CCN=C2c1ccc(S(N)(=O)=O)cc1.
What is the InChIKey of 4-(6-methoxy-3,4-dihydroisoquinolin-1-yl)benzenesulfonamide?
The InChIKey is RZQVMYVIRNCVDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O3S/c1-21-13-4-7-15-12(10-13)8-9-18-16(15)11-2-5-14(6-3-11)22(17,19)20/h2-7,10H,8-9H2,1H3,(H2,17,19,20).
What are the key properties of 4-(6-methoxy-3,4-dihydroisoquinolin-1-yl)benzenesulfonamide?
4-(6-methoxy-3,4-dihydroisoquinolin-1-yl)benzenesulfonamide has a molecular weight of 316.38 g/mol, XLogP of 1.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-methoxy-3,4-dihydroisoquinolin-1-yl)benzenesulfonamide is sourced from PubChem (CID 56928044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).