C23H13Cl2F3N6 — CID 56928285
N-[(1R)-1-[8-chloro-2-(6-chloro-3-pyridinyl)quinolin-3-yl]-2,2,2-trifluoroethyl]pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 56928285) has the molecular formula C23H13Cl2F3N6 and a molecular weight of 501.30 g/mol. Its IUPAC name is N-[(1R)-1-[8-chloro-2-(6-chloro-3-pyridinyl)quinolin-3-yl]-2,2,2-trifluoroethyl]pyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[(1R)-1-[8-chloro-2-(6-chloro-3-pyridinyl)quinolin-3-yl]-2,2,2-trifluoroethyl]pyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 56928285 |
| Molecular Formula | C23H13Cl2F3N6 |
| Molecular Weight | 501.30 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | N-[(1R)-1-[8-chloro-2-(6-chloro-3-pyridinyl)quinolin-3-yl]-2,2,2-trifluoroethyl]pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | FC(F)(F)[C@H](Nc1ncnc2cccnc12)c1cc2cccc(Cl)c2nc1-c1ccc(Cl)nc1 |
| InChI | InChI=1S/C23H13Cl2F3N6/c24-15-4-1-3-12-9-14(18(33-19(12)15)13-6-7-17(25)30-10-13)21(23(26,27)28)34-22-20-16(31-11-32-22)5-2-8-29-20/h1-11,21H,(H,31,32,34)/t21-/m1/s1 |
| InChIKey | XYIFFGRMYFDNFK-OAQYLSRUSA-N |
| XLogP | 6.66 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.30 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|