About [4-(3,5-dibromobenzoyl)piperazin-1-yl]-phenylmethanone
[4-(3,5-dibromobenzoyl)piperazin-1-yl]-phenylmethanone (PubChem CID 569283) has the molecular formula C18H16Br2N2O2
and a molecular weight of 452.15 g/mol. Its IUPAC name is [4-(3,5-dibromobenzoyl)piperazin-1-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [4-(3,5-dibromobenzoyl)piperazin-1-yl]-phenylmethanone |
| PubChem CID | 569283 |
| Molecular Formula | C18H16Br2N2O2 |
| Molecular Weight | 452.15 g/mol |
| Exact Mass | 449.96 |
| IUPAC Name | [4-(3,5-dibromobenzoyl)piperazin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCN(C(=O)c2cc(Br)cc(Br)c2)CC1 |
| InChI | InChI=1S/C18H16Br2N2O2/c19-15-10-14(11-16(20)12-15)18(24)22-8-6-21(7-9-22)17(23)13-4-2-1-3-5-13/h1-5,10-12H,6-9H2 |
| InChIKey | UKPAFNGVPPFFFZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.15 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-(3,5-dibromobenzoyl)piperazin-1-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,5-dibromobenzoyl)piperazin-1-yl]-phenylmethanone?
The IUPAC name of [4-(3,5-dibromobenzoyl)piperazin-1-yl]-phenylmethanone (CID 569283) is [4-(3,5-dibromobenzoyl)piperazin-1-yl]-phenylmethanone.
What is the SMILES notation for [4-(3,5-dibromobenzoyl)piperazin-1-yl]-phenylmethanone?
The canonical SMILES for [4-(3,5-dibromobenzoyl)piperazin-1-yl]-phenylmethanone is O=C(c1ccccc1)N1CCN(C(=O)c2cc(Br)cc(Br)c2)CC1.
What is the InChIKey of [4-(3,5-dibromobenzoyl)piperazin-1-yl]-phenylmethanone?
The InChIKey is UKPAFNGVPPFFFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16Br2N2O2/c19-15-10-14(11-16(20)12-15)18(24)22-8-6-21(7-9-22)17(23)13-4-2-1-3-5-13/h1-5,10-12H,6-9H2.
What are the key properties of [4-(3,5-dibromobenzoyl)piperazin-1-yl]-phenylmethanone?
[4-(3,5-dibromobenzoyl)piperazin-1-yl]-phenylmethanone has a molecular weight of 452.15 g/mol, XLogP of 3.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,5-dibromobenzoyl)piperazin-1-yl]-phenylmethanone is sourced from PubChem (CID 569283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).