C31H34N2O3S — CID 56928562
4-methyl-N-[(1R,2R)-2-[2-[(3-methylphenyl)methoxy]ethylamino]-1,2-diphenylethyl]benzenesulfonamide (PubChem CID 56928562) has the molecular formula C31H34N2O3S and a molecular weight of 514.69 g/mol. Its IUPAC name is 4-methyl-N-[(1R,2R)-2-[2-[(3-methylphenyl)methoxy]ethylamino]-1,2-diphenylethyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(1R,2R)-2-[2-[(3-methylphenyl)methoxy]ethylamino]-1,2-diphenylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 56928562 |
| Molecular Formula | C31H34N2O3S |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 4-methyl-N-[(1R,2R)-2-[2-[(3-methylphenyl)methoxy]ethylamino]-1,2-diphenylethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](c2ccccc2)[C@H](NCCOCc2cccc(C)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H34N2O3S/c1-24-16-18-29(19-17-24)37(34,35)33-31(28-14-7-4-8-15-28)30(27-12-5-3-6-13-27)32-20-21-36-23-26-11-9-10-25(2)22-26/h3-19,22,30-33H,20-21,23H2,1-2H3/t30-,31-/m1/s1 |
| InChIKey | DDQMGWHKVJDTKB-FIRIVFDPSA-N |
| XLogP | 5.87 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|