C31H31F3N2O3S — CID 56928564
N-[(1R,2R)-2-[2-[(4-methylphenyl)methoxy]ethylamino]-1,2-diphenylethyl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 56928564) has the molecular formula C31H31F3N2O3S and a molecular weight of 568.66 g/mol. Its IUPAC name is N-[(1R,2R)-2-[2-[(4-methylphenyl)methoxy]ethylamino]-1,2-diphenylethyl]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(1R,2R)-2-[2-[(4-methylphenyl)methoxy]ethylamino]-1,2-diphenylethyl]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 56928564 |
| Molecular Formula | C31H31F3N2O3S |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | N-[(1R,2R)-2-[2-[(4-methylphenyl)methoxy]ethylamino]-1,2-diphenylethyl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1ccc(COCCN[C@H](c2ccccc2)[C@H](NS(=O)(=O)c2ccccc2C(F)(F)F)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H31F3N2O3S/c1-23-16-18-24(19-17-23)22-39-21-20-35-29(25-10-4-2-5-11-25)30(26-12-6-3-7-13-26)36-40(37,38)28-15-9-8-14-27(28)31(32,33)34/h2-19,29-30,35-36H,20-22H2,1H3/t29-,30-/m1/s1 |
| InChIKey | JECVXOFWMNFUJO-LOYHVIPDSA-N |
| XLogP | 6.58 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|