C13H7Br3O5 — CID 56928726
(2-bromo-3,4-dihydroxyphenyl)-(2,3-dibromo-4,5-dihydroxyphenyl)methanone (PubChem CID 56928726) has the molecular formula C13H7Br3O5 and a molecular weight of 482.91 g/mol. Its IUPAC name is (2-bromo-3,4-dihydroxyphenyl)-(2,3-dibromo-4,5-dihydroxyphenyl)methanone.
| Compound Name | (2-bromo-3,4-dihydroxyphenyl)-(2,3-dibromo-4,5-dihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 56928726 |
| Molecular Formula | C13H7Br3O5 |
| Molecular Weight | 482.91 g/mol |
| Exact Mass | 479.78 |
| IUPAC Name | (2-bromo-3,4-dihydroxyphenyl)-(2,3-dibromo-4,5-dihydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)c(O)c1Br)c1cc(O)c(O)c(Br)c1Br |
| InChI | InChI=1S/C13H7Br3O5/c14-8-5(3-7(18)13(21)10(8)16)11(19)4-1-2-6(17)12(20)9(4)15/h1-3,17-18,20-21H |
| InChIKey | RSSWHRALOZERPV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.91 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|