C27H27F3N6O2 — CID 56929378
N-cyclopropyl-4-[6-(4-methoxyanilino)-8-(3,3,3-trifluoropropylamino)imidazo[1,2-b]pyridazin-3-yl]-2-methylbenzamide (PubChem CID 56929378) has the molecular formula C27H27F3N6O2 and a molecular weight of 524.55 g/mol. Its IUPAC name is N-cyclopropyl-4-[6-(4-methoxyanilino)-8-(3,3,3-trifluoropropylamino)imidazo[1,2-b]pyridazin-3-yl]-2-methylbenzamide.
| Compound Name | N-cyclopropyl-4-[6-(4-methoxyanilino)-8-(3,3,3-trifluoropropylamino)imidazo[1,2-b]pyridazin-3-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 56929378 |
| Molecular Formula | C27H27F3N6O2 |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | N-cyclopropyl-4-[6-(4-methoxyanilino)-8-(3,3,3-trifluoropropylamino)imidazo[1,2-b]pyridazin-3-yl]-2-methylbenzamide |
| SMILES | COc1ccc(Nc2cc(NCCC(F)(F)F)c3ncc(-c4ccc(C(=O)NC5CC5)c(C)c4)n3n2)cc1 |
| InChI | InChI=1S/C27H27F3N6O2/c1-16-13-17(3-10-21(16)26(37)34-19-4-5-19)23-15-32-25-22(31-12-11-27(28,29)30)14-24(35-36(23)25)33-18-6-8-20(38-2)9-7-18/h3,6-10,13-15,19,31H,4-5,11-12H2,1-2H3,(H,33,35)(H,34,37) |
| InChIKey | DPDANNAASUSFTK-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|