C18H21FO5S — CID 56929386
(2R,3R,4S,5S,6R)-2-[5-[(4-fluorophenyl)methyl]-4-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 56929386) has the molecular formula C18H21FO5S and a molecular weight of 368.43 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[5-[(4-fluorophenyl)methyl]-4-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[5-[(4-fluorophenyl)methyl]-4-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 56929386 |
| Molecular Formula | C18H21FO5S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[5-[(4-fluorophenyl)methyl]-4-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1cc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)sc1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H21FO5S/c1-9-6-14(18-17(23)16(22)15(21)12(8-20)24-18)25-13(9)7-10-2-4-11(19)5-3-10/h2-6,12,15-18,20-23H,7-8H2,1H3/t12-,15-,16+,17-,18+/m1/s1 |
| InChIKey | DPAMOFLLEAYFMO-CUWKQTPXSA-N |
| XLogP | 1.30 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |