C15H23NO2S — CID 56929610
1-(1,1,2,2,3,3,3-heptadeuteriopropyl)-4-(3-methylsulfonylphenyl)piperidine (PubChem CID 56929610) has the molecular formula C15H23NO2S and a molecular weight of 288.46 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,3-heptadeuteriopropyl)-4-(3-methylsulfonylphenyl)piperidine.
| Compound Name | 1-(1,1,2,2,3,3,3-heptadeuteriopropyl)-4-(3-methylsulfonylphenyl)piperidine |
|---|---|
| PubChem CID | 56929610 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 1-(1,1,2,2,3,3,3-heptadeuteriopropyl)-4-(3-methylsulfonylphenyl)piperidine |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])N1CCC(c2cccc(S(C)(=O)=O)c2)CC1 |
| InChI | InChI=1S/C15H23NO2S/c1-3-9-16-10-7-13(8-11-16)14-5-4-6-15(12-14)19(2,17)18/h4-6,12-13H,3,7-11H2,1-2H3/i1D3,3D2,9D2 |
| InChIKey | YGKUEOZJFIXDGI-MADFRBAASA-N |
| XLogP | 2.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |