C19H36O5Si — CID 56930364
tert-butyl-[[(4S,5S)-5-[(4R)-2,2-dimethyl-5-methylidene-1,3-dioxan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane (PubChem CID 56930364) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is tert-butyl-[[(4S,5S)-5-[(4R)-2,2-dimethyl-5-methylidene-1,3-dioxan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(4S,5S)-5-[(4R)-2,2-dimethyl-5-methylidene-1,3-dioxan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 56930364 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | tert-butyl-[[(4S,5S)-5-[(4R)-2,2-dimethyl-5-methylidene-1,3-dioxan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane |
| SMILES | C=C1COC(C)(C)O[C@H]1[C@@H]1OC(C)(C)O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O5Si/c1-13-11-20-18(5,6)23-15(13)16-14(22-19(7,8)24-16)12-21-25(9,10)17(2,3)4/h14-16H,1,11-12H2,2-10H3/t14-,15+,16+/m0/s1 |
| InChIKey | ZZVGTKGEURLMAW-ARFHVFGLSA-N |
| XLogP | 4.24 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|