C25H30ClN3OS — CID 56930476
N-[3-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]propyl]-5-thiophen-2-ylpentanamide (PubChem CID 56930476) has the molecular formula C25H30ClN3OS and a molecular weight of 456.06 g/mol. Its IUPAC name is N-[3-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]propyl]-5-thiophen-2-ylpentanamide.
| Compound Name | N-[3-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]propyl]-5-thiophen-2-ylpentanamide |
|---|---|
| PubChem CID | 56930476 |
| Molecular Formula | C25H30ClN3OS |
| Molecular Weight | 456.06 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | N-[3-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]propyl]-5-thiophen-2-ylpentanamide |
| SMILES | O=C(CCCCc1cccs1)NCCCNc1c2c(nc3cc(Cl)ccc13)CCCC2 |
| InChI | InChI=1S/C25H30ClN3OS/c26-18-12-13-21-23(17-18)29-22-10-3-2-9-20(22)25(21)28-15-6-14-27-24(30)11-4-1-7-19-8-5-16-31-19/h5,8,12-13,16-17H,1-4,6-7,9-11,14-15H2,(H,27,30)(H,28,29) |
| InChIKey | GLEYGYRXUBEHAQ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.06 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|