C39H48O6Si — CID 56930738
[(1S,6R,7S,8S)-7-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4,4-dimethyl-10-oxo-3,5-dioxatricyclo[6.2.2.01,6]dodecan-8-yl]methyl benzoate (PubChem CID 56930738) has the molecular formula C39H48O6Si and a molecular weight of 640.89 g/mol. Its IUPAC name is [(1S,6R,7S,8S)-7-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4,4-dimethyl-10-oxo-3,5-dioxatricyclo[6.2.2.01,6]dodecan-8-yl]methyl benzoate.
| Compound Name | [(1S,6R,7S,8S)-7-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4,4-dimethyl-10-oxo-3,5-dioxatricyclo[6.2.2.01,6]dodecan-8-yl]methyl benzoate |
|---|---|
| PubChem CID | 56930738 |
| Molecular Formula | C39H48O6Si |
| Molecular Weight | 640.89 g/mol |
| Exact Mass | 640.32 |
| IUPAC Name | [(1S,6R,7S,8S)-7-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4,4-dimethyl-10-oxo-3,5-dioxatricyclo[6.2.2.01,6]dodecan-8-yl]methyl benzoate |
| SMILES | CC1(C)OC[C@]23CC[C@](COC(=O)c4ccccc4)(CC2=O)[C@H](CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]3O1 |
| InChI | InChI=1S/C39H48O6Si/c1-36(2,3)46(30-18-11-7-12-19-30,31-20-13-8-14-21-31)44-25-15-22-32-34-39(28-43-37(4,5)45-34)24-23-38(32,26-33(39)40)27-42-35(41)29-16-9-6-10-17-29/h6-14,16-21,32,34H,15,22-28H2,1-5H3/t32-,34-,38-,39-/m1/s1 |
| InChIKey | IPLVNEVTMQGVFZ-RSHYXDRCSA-N |
| XLogP | 6.71 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.89 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|