C19H28N2O — CID 56930789
1-(butylamino)-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propan-2-ol (PubChem CID 56930789) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is 1-(butylamino)-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propan-2-ol.
| Compound Name | 1-(butylamino)-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propan-2-ol |
|---|---|
| PubChem CID | 56930789 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 1-(butylamino)-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propan-2-ol |
| SMILES | CCCCNCC(O)Cn1c2c(c3ccccc31)CCCC2 |
| InChI | InChI=1S/C19H28N2O/c1-2-3-12-20-13-15(22)14-21-18-10-6-4-8-16(18)17-9-5-7-11-19(17)21/h4,6,8,10,15,20,22H,2-3,5,7,9,11-14H2,1H3 |
| InChIKey | VTNKXNAIJLISBW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|