C21H18N2O4 — CID 56930797
6-(4-nitrophenyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one (PubChem CID 56930797) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is 6-(4-nitrophenyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one.
| Compound Name | 6-(4-nitrophenyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one |
|---|---|
| PubChem CID | 56930797 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 6-(4-nitrophenyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one |
| SMILES | O=c1cc(-c2ccc([N+](=O)[O-])cc2)c2cc3c4c(c2o1)CCCN4CCC3 |
| InChI | InChI=1S/C21H18N2O4/c24-19-12-17(13-5-7-15(8-6-13)23(25)26)18-11-14-3-1-9-22-10-2-4-16(20(14)22)21(18)27-19/h5-8,11-12H,1-4,9-10H2 |
| InChIKey | RTEAVYBDIBAMIP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 76.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|