About N-[(E)-[1-(4-chlorophenyl)-3-phenylpyrazol-4-yl]methylideneamino]-2,4-dinitroaniline
N-[(E)-[1-(4-chlorophenyl)-3-phenylpyrazol-4-yl]methylideneamino]-2,4-dinitroaniline (PubChem CID 56930886) has the molecular formula C22H15ClN6O4
and a molecular weight of 462.85 g/mol. Its IUPAC name is N-[(E)-[1-(4-chlorophenyl)-3-phenylpyrazol-4-yl]methylideneamino]-2,4-dinitroaniline.
Molecular Properties
| Compound Name | N-[(E)-[1-(4-chlorophenyl)-3-phenylpyrazol-4-yl]methylideneamino]-2,4-dinitroaniline |
| PubChem CID | 56930886 |
| Molecular Formula | C22H15ClN6O4 |
| Molecular Weight | 462.85 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | N-[(E)-[1-(4-chlorophenyl)-3-phenylpyrazol-4-yl]methylideneamino]-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C/c2cn(-c3ccc(Cl)cc3)nc2-c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H15ClN6O4/c23-17-6-8-18(9-7-17)27-14-16(22(26-27)15-4-2-1-3-5-15)13-24-25-20-11-10-19(28(30)31)12-21(20)29(32)33/h1-14,25H/b24-13+ |
| InChIKey | TZQFQNCRSMTMRI-ZMOGYAJESA-N |
| XLogP | 5.46 |
| TPSA | 128.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.85 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-[1-(4-chlorophenyl)-3-phenylpyrazol-4-yl]methylideneamino]-2,4-dinitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-[1-(4-chlorophenyl)-3-phenylpyrazol-4-yl]methylideneamino]-2,4-dinitroaniline?
The IUPAC name of N-[(E)-[1-(4-chlorophenyl)-3-phenylpyrazol-4-yl]methylideneamino]-2,4-dinitroaniline (CID 56930886) is N-[(E)-[1-(4-chlorophenyl)-3-phenylpyrazol-4-yl]methylideneamino]-2,4-dinitroaniline.
What is the SMILES notation for N-[(E)-[1-(4-chlorophenyl)-3-phenylpyrazol-4-yl]methylideneamino]-2,4-dinitroaniline?
The canonical SMILES for N-[(E)-[1-(4-chlorophenyl)-3-phenylpyrazol-4-yl]methylideneamino]-2,4-dinitroaniline is O=[N+]([O-])c1ccc(N/N=C/c2cn(-c3ccc(Cl)cc3)nc2-c2ccccc2)c([N+](=O)[O-])c1.
What is the InChIKey of N-[(E)-[1-(4-chlorophenyl)-3-phenylpyrazol-4-yl]methylideneamino]-2,4-dinitroaniline?
The InChIKey is TZQFQNCRSMTMRI-ZMOGYAJESA-N. The full InChI is InChI=1S/C22H15ClN6O4/c23-17-6-8-18(9-7-17)27-14-16(22(26-27)15-4-2-1-3-5-15)13-24-25-20-11-10-19(28(30)31)12-21(20)29(32)33/h1-14,25H/b24-13+.
What are the key properties of N-[(E)-[1-(4-chlorophenyl)-3-phenylpyrazol-4-yl]methylideneamino]-2,4-dinitroaniline?
N-[(E)-[1-(4-chlorophenyl)-3-phenylpyrazol-4-yl]methylideneamino]-2,4-dinitroaniline has a molecular weight of 462.85 g/mol, XLogP of 5.46, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-[1-(4-chlorophenyl)-3-phenylpyrazol-4-yl]methylideneamino]-2,4-dinitroaniline is sourced from PubChem (CID 56930886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).