About 4-phenyl-N-(4-phenyl-1,3-oxazol-2-yl)-1H-pyrazole-5-carboxamide
4-phenyl-N-(4-phenyl-1,3-oxazol-2-yl)-1H-pyrazole-5-carboxamide (PubChem CID 56931051) has the molecular formula C19H14N4O2
and a molecular weight of 330.35 g/mol. Its IUPAC name is 4-phenyl-N-(4-phenyl-1,3-oxazol-2-yl)-1H-pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-phenyl-N-(4-phenyl-1,3-oxazol-2-yl)-1H-pyrazole-5-carboxamide |
| PubChem CID | 56931051 |
| Molecular Formula | C19H14N4O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 4-phenyl-N-(4-phenyl-1,3-oxazol-2-yl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)co1)c1[nH]ncc1-c1ccccc1 |
| InChI | InChI=1S/C19H14N4O2/c24-18(17-15(11-20-23-17)13-7-3-1-4-8-13)22-19-21-16(12-25-19)14-9-5-2-6-10-14/h1-12H,(H,20,23)(H,21,22,24) |
| InChIKey | JDCQYDQKTPMFQK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-phenyl-N-(4-phenyl-1,3-oxazol-2-yl)-1H-pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-N-(4-phenyl-1,3-oxazol-2-yl)-1H-pyrazole-5-carboxamide?
The IUPAC name of 4-phenyl-N-(4-phenyl-1,3-oxazol-2-yl)-1H-pyrazole-5-carboxamide (CID 56931051) is 4-phenyl-N-(4-phenyl-1,3-oxazol-2-yl)-1H-pyrazole-5-carboxamide.
What is the SMILES notation for 4-phenyl-N-(4-phenyl-1,3-oxazol-2-yl)-1H-pyrazole-5-carboxamide?
The canonical SMILES for 4-phenyl-N-(4-phenyl-1,3-oxazol-2-yl)-1H-pyrazole-5-carboxamide is O=C(Nc1nc(-c2ccccc2)co1)c1[nH]ncc1-c1ccccc1.
What is the InChIKey of 4-phenyl-N-(4-phenyl-1,3-oxazol-2-yl)-1H-pyrazole-5-carboxamide?
The InChIKey is JDCQYDQKTPMFQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N4O2/c24-18(17-15(11-20-23-17)13-7-3-1-4-8-13)22-19-21-16(12-25-19)14-9-5-2-6-10-14/h1-12H,(H,20,23)(H,21,22,24).
What are the key properties of 4-phenyl-N-(4-phenyl-1,3-oxazol-2-yl)-1H-pyrazole-5-carboxamide?
4-phenyl-N-(4-phenyl-1,3-oxazol-2-yl)-1H-pyrazole-5-carboxamide has a molecular weight of 330.35 g/mol, XLogP of 3.98, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-N-(4-phenyl-1,3-oxazol-2-yl)-1H-pyrazole-5-carboxamide is sourced from PubChem (CID 56931051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).