About CID 56931140
CID 56931140 (PubChem CID 56931140) has the molecular formula C39H45N2+
and a molecular weight of 541.80 g/mol.
Molecular Properties
| Compound Name | CID 56931140 |
| PubChem CID | 56931140 |
| Molecular Formula | C39H45N2+ |
| Molecular Weight | 541.80 g/mol |
| Exact Mass | 541.36 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(c2ccccc2)=[N+](c2c(C(C)C)cccc2C(C)C)[C]C1c1ccccc1 |
| InChI | InChI=1S/C39H45N2/c1-26(2)32-21-15-22-33(27(3)4)37(32)40-25-36(30-17-11-9-12-18-30)41(39(40)31-19-13-10-14-20-31)38-34(28(5)6)23-16-24-35(38)29(7)8/h9-24,26-29,36H,1-8H3/q+1 |
| InChIKey | FQOADXIQVKWKEE-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 541.80 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 56931140 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 56931140?
The IUPAC name of CID 56931140 (CID 56931140) is not available.
What is the SMILES notation for CID 56931140?
The canonical SMILES for CID 56931140 is CC(C)c1cccc(C(C)C)c1N1C(c2ccccc2)=[N+](c2c(C(C)C)cccc2C(C)C)[C]C1c1ccccc1.
What is the InChIKey of CID 56931140?
The InChIKey is FQOADXIQVKWKEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H45N2/c1-26(2)32-21-15-22-33(27(3)4)37(32)40-25-36(30-17-11-9-12-18-30)41(39(40)31-19-13-10-14-20-31)38-34(28(5)6)23-16-24-35(38)29(7)8/h9-24,26-29,36H,1-8H3/q+1.
What are the key properties of CID 56931140?
CID 56931140 has a molecular weight of 541.80 g/mol, XLogP of 10.57, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 56931140 is sourced from PubChem (CID 56931140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).