C24H22N4O2 — CID 56931580
ethyl 2-amino-8-methyl-4-pyridin-3-yl-6,11-dihydro-5H-pyrido[2,3-a]carbazole-3-carboxylate (PubChem CID 56931580) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is ethyl 2-amino-8-methyl-4-pyridin-3-yl-6,11-dihydro-5H-pyrido[2,3-a]carbazole-3-carboxylate.
| Compound Name | ethyl 2-amino-8-methyl-4-pyridin-3-yl-6,11-dihydro-5H-pyrido[2,3-a]carbazole-3-carboxylate |
|---|---|
| PubChem CID | 56931580 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | ethyl 2-amino-8-methyl-4-pyridin-3-yl-6,11-dihydro-5H-pyrido[2,3-a]carbazole-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)nc2c(c1-c1cccnc1)CCc1c-2[nH]c2ccc(C)cc12 |
| InChI | InChI=1S/C24H22N4O2/c1-3-30-24(29)20-19(14-5-4-10-26-12-14)16-8-7-15-17-11-13(2)6-9-18(17)27-21(15)22(16)28-23(20)25/h4-6,9-12,27H,3,7-8H2,1-2H3,(H2,25,28) |
| InChIKey | ZDPCDOMEDVBWIS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|