C24H21N5O5 — CID 56931867
6,7-dimethoxy-N-(4-nitrophenyl)-3-pyridin-4-yl-3a,4-dihydro-3H-indeno[1,2-c]pyrazole-2-carboxamide (PubChem CID 56931867) has the molecular formula C24H21N5O5 and a molecular weight of 459.46 g/mol. Its IUPAC name is 6,7-dimethoxy-N-(4-nitrophenyl)-3-pyridin-4-yl-3a,4-dihydro-3H-indeno[1,2-c]pyrazole-2-carboxamide.
| Compound Name | 6,7-dimethoxy-N-(4-nitrophenyl)-3-pyridin-4-yl-3a,4-dihydro-3H-indeno[1,2-c]pyrazole-2-carboxamide |
|---|---|
| PubChem CID | 56931867 |
| Molecular Formula | C24H21N5O5 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 6,7-dimethoxy-N-(4-nitrophenyl)-3-pyridin-4-yl-3a,4-dihydro-3H-indeno[1,2-c]pyrazole-2-carboxamide |
| SMILES | COc1cc2c(cc1OC)C1=NN(C(=O)Nc3ccc([N+](=O)[O-])cc3)C(c3ccncc3)C1C2 |
| InChI | InChI=1S/C24H21N5O5/c1-33-20-12-15-11-19-22(18(15)13-21(20)34-2)27-28(23(19)14-7-9-25-10-8-14)24(30)26-16-3-5-17(6-4-16)29(31)32/h3-10,12-13,19,23H,11H2,1-2H3,(H,26,30) |
| InChIKey | VTGYCLNFOBFNOU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 119.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|