C10H18F2N2O2 — CID 56932105
tert-butyl 4-amino-3,3-difluoropiperidine-1-carboxylate (PubChem CID 56932105) has the molecular formula C10H18F2N2O2 and a molecular weight of 236.26 g/mol. Its IUPAC name is tert-butyl 4-amino-3,3-difluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-amino-3,3-difluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 56932105 |
| Molecular Formula | C10H18F2N2O2 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | tert-butyl 4-amino-3,3-difluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N)C(F)(F)C1 |
| InChI | InChI=1S/C10H18F2N2O2/c1-9(2,3)16-8(15)14-5-4-7(13)10(11,12)6-14/h7H,4-6,13H2,1-3H3 |
| InChIKey | APZOOTJWPGQYSZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |