C12H11N3O3S2 — CID 56932123
4-(2-pyrimidin-2-ylsulfanylacetyl)benzenesulfonamide (PubChem CID 56932123) has the molecular formula C12H11N3O3S2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-(2-pyrimidin-2-ylsulfanylacetyl)benzenesulfonamide.
| Compound Name | 4-(2-pyrimidin-2-ylsulfanylacetyl)benzenesulfonamide |
|---|---|
| PubChem CID | 56932123 |
| Molecular Formula | C12H11N3O3S2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 4-(2-pyrimidin-2-ylsulfanylacetyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)CSc2ncccn2)cc1 |
| InChI | InChI=1S/C12H11N3O3S2/c13-20(17,18)10-4-2-9(3-5-10)11(16)8-19-12-14-6-1-7-15-12/h1-7H,8H2,(H2,13,17,18) |
| InChIKey | GQFCFNQXNFZIFC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |