C24H22F6N2O3S2 — CID 56932319
2-[4-[(2S)-2-benzyl-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 56932319) has the molecular formula C24H22F6N2O3S2 and a molecular weight of 564.57 g/mol. Its IUPAC name is 2-[4-[(2S)-2-benzyl-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[(2S)-2-benzyl-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 56932319 |
| Molecular Formula | C24H22F6N2O3S2 |
| Molecular Weight | 564.57 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | 2-[4-[(2S)-2-benzyl-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | O=S(=O)(c1cccs1)N1CCN(c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)[C@@H](Cc2ccccc2)C1 |
| InChI | InChI=1S/C24H22F6N2O3S2/c25-23(26,27)22(33,24(28,29)30)18-8-10-19(11-9-18)32-13-12-31(37(34,35)21-7-4-14-36-21)16-20(32)15-17-5-2-1-3-6-17/h1-11,14,20,33H,12-13,15-16H2/t20-/m0/s1 |
| InChIKey | AWNCHMGZVLPMGJ-FQEVSTJZSA-N |
| XLogP | 5.18 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|