C20H18ClN5O2 — CID 56932800
7-[[4-(6-chloro-3-pyridinyl)pyrimidin-2-yl]amino]-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 56932800) has the molecular formula C20H18ClN5O2 and a molecular weight of 395.85 g/mol. Its IUPAC name is 7-[[4-(6-chloro-3-pyridinyl)pyrimidin-2-yl]amino]-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | 7-[[4-(6-chloro-3-pyridinyl)pyrimidin-2-yl]amino]-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 56932800 |
| Molecular Formula | C20H18ClN5O2 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 7-[[4-(6-chloro-3-pyridinyl)pyrimidin-2-yl]amino]-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)CC(Nc1nccc(-c3ccc(Cl)nc3)n1)CC2 |
| InChI | InChI=1S/C20H18ClN5O2/c21-18-6-4-14(11-23-18)17-7-8-22-20(25-17)24-16-5-3-12-1-2-13(19(27)26-28)9-15(12)10-16/h1-2,4,6-9,11,16,28H,3,5,10H2,(H,26,27)(H,22,24,25) |
| InChIKey | GUSIXONWBMQKIS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|