About triethyl-[(1S,2S)-2-methyl-5-phenylsulfanylcyclohepta-3,5-dien-1-yl]oxysilane
triethyl-[(1S,2S)-2-methyl-5-phenylsulfanylcyclohepta-3,5-dien-1-yl]oxysilane (PubChem CID 56933457) has the molecular formula C20H30OSSi
and a molecular weight of 346.61 g/mol. Its IUPAC name is triethyl-[(1S,2S)-2-methyl-5-phenylsulfanylcyclohepta-3,5-dien-1-yl]oxysilane.
Molecular Properties
| Compound Name | triethyl-[(1S,2S)-2-methyl-5-phenylsulfanylcyclohepta-3,5-dien-1-yl]oxysilane |
| PubChem CID | 56933457 |
| Molecular Formula | C20H30OSSi |
| Molecular Weight | 346.61 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | triethyl-[(1S,2S)-2-methyl-5-phenylsulfanylcyclohepta-3,5-dien-1-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC=C(Sc2ccccc2)C=C[C@@H]1C |
| InChI | InChI=1S/C20H30OSSi/c1-5-23(6-2,7-3)21-20-16-15-19(14-13-17(20)4)22-18-11-9-8-10-12-18/h8-15,17,20H,5-7,16H2,1-4H3/t17-,20-/m0/s1 |
| InChIKey | MZMUSCOZVHXMIP-PXNSSMCTSA-N |
| XLogP | 6.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.61 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(1S,2S)-2-methyl-5-phenylsulfanylcyclohepta-3,5-dien-1-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(1S,2S)-2-methyl-5-phenylsulfanylcyclohepta-3,5-dien-1-yl]oxysilane?
The IUPAC name of triethyl-[(1S,2S)-2-methyl-5-phenylsulfanylcyclohepta-3,5-dien-1-yl]oxysilane (CID 56933457) is triethyl-[(1S,2S)-2-methyl-5-phenylsulfanylcyclohepta-3,5-dien-1-yl]oxysilane.
What is the SMILES notation for triethyl-[(1S,2S)-2-methyl-5-phenylsulfanylcyclohepta-3,5-dien-1-yl]oxysilane?
The canonical SMILES for triethyl-[(1S,2S)-2-methyl-5-phenylsulfanylcyclohepta-3,5-dien-1-yl]oxysilane is CC[Si](CC)(CC)O[C@H]1CC=C(Sc2ccccc2)C=C[C@@H]1C.
What is the InChIKey of triethyl-[(1S,2S)-2-methyl-5-phenylsulfanylcyclohepta-3,5-dien-1-yl]oxysilane?
The InChIKey is MZMUSCOZVHXMIP-PXNSSMCTSA-N. The full InChI is InChI=1S/C20H30OSSi/c1-5-23(6-2,7-3)21-20-16-15-19(14-13-17(20)4)22-18-11-9-8-10-12-18/h8-15,17,20H,5-7,16H2,1-4H3/t17-,20-/m0/s1.
What are the key properties of triethyl-[(1S,2S)-2-methyl-5-phenylsulfanylcyclohepta-3,5-dien-1-yl]oxysilane?
triethyl-[(1S,2S)-2-methyl-5-phenylsulfanylcyclohepta-3,5-dien-1-yl]oxysilane has a molecular weight of 346.61 g/mol, XLogP of 6.65, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(1S,2S)-2-methyl-5-phenylsulfanylcyclohepta-3,5-dien-1-yl]oxysilane is sourced from PubChem (CID 56933457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).