C25H23N7O2S — CID 56933477
1-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]-3-phenylurea (PubChem CID 56933477) has the molecular formula C25H23N7O2S and a molecular weight of 485.57 g/mol. Its IUPAC name is 1-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]-3-phenylurea.
| Compound Name | 1-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]-3-phenylurea |
|---|---|
| PubChem CID | 56933477 |
| Molecular Formula | C25H23N7O2S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 1-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]-3-phenylurea |
| SMILES | COc1cccc(-c2nc3sccn3c2-c2ccnc(NCCNC(=O)Nc3ccccc3)n2)c1 |
| InChI | InChI=1S/C25H23N7O2S/c1-34-19-9-5-6-17(16-19)21-22(32-14-15-35-25(32)31-21)20-10-11-26-23(30-20)27-12-13-28-24(33)29-18-7-3-2-4-8-18/h2-11,14-16H,12-13H2,1H3,(H,26,27,30)(H2,28,29,33) |
| InChIKey | YFMIENWRRLJIBZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|