C25H22N6O2S — CID 56933615
N-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzamide (PubChem CID 56933615) has the molecular formula C25H22N6O2S and a molecular weight of 470.56 g/mol. Its IUPAC name is N-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzamide.
| Compound Name | N-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 56933615 |
| Molecular Formula | C25H22N6O2S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | N-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzamide |
| SMILES | COc1cccc(-c2nc3sccn3c2-c2ccnc(NCCNC(=O)c3ccccc3)n2)c1 |
| InChI | InChI=1S/C25H22N6O2S/c1-33-19-9-5-8-18(16-19)21-22(31-14-15-34-25(31)30-21)20-10-11-27-24(29-20)28-13-12-26-23(32)17-6-3-2-4-7-17/h2-11,14-16H,12-13H2,1H3,(H,26,32)(H,27,28,29) |
| InChIKey | WZMDUFHQBUYUNR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|