C25H22N6O3S — CID 56933616
2-hydroxy-N-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzamide (PubChem CID 56933616) has the molecular formula C25H22N6O3S and a molecular weight of 486.56 g/mol. Its IUPAC name is 2-hydroxy-N-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzamide.
| Compound Name | 2-hydroxy-N-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 56933616 |
| Molecular Formula | C25H22N6O3S |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 2-hydroxy-N-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzamide |
| SMILES | COc1cccc(-c2nc3sccn3c2-c2ccnc(NCCNC(=O)c3ccccc3O)n2)c1 |
| InChI | InChI=1S/C25H22N6O3S/c1-34-17-6-4-5-16(15-17)21-22(31-13-14-35-25(31)30-21)19-9-10-27-24(29-19)28-12-11-26-23(33)18-7-2-3-8-20(18)32/h2-10,13-15,32H,11-12H2,1H3,(H,26,33)(H,27,28,29) |
| InChIKey | QLFXCUIWPKPEKU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|