C13H10N2O2 — CID 56933866
(4aR,8aS)-2-methyl-5,8-dioxo-1,4-dihydronaphthalene-4a,8a-dicarbonitrile (PubChem CID 56933866) has the molecular formula C13H10N2O2 and a molecular weight of 226.23 g/mol. Its IUPAC name is (4aR,8aS)-2-methyl-5,8-dioxo-1,4-dihydronaphthalene-4a,8a-dicarbonitrile.
| Compound Name | (4aR,8aS)-2-methyl-5,8-dioxo-1,4-dihydronaphthalene-4a,8a-dicarbonitrile |
|---|---|
| PubChem CID | 56933866 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | (4aR,8aS)-2-methyl-5,8-dioxo-1,4-dihydronaphthalene-4a,8a-dicarbonitrile |
| SMILES | CC1=CC[C@@]2(C#N)C(=O)C=CC(=O)[C@@]2(C#N)C1 |
| InChI | InChI=1S/C13H10N2O2/c1-9-4-5-12(7-14)10(16)2-3-11(17)13(12,6-9)8-15/h2-4H,5-6H2,1H3/t12-,13+/m1/s1 |
| InChIKey | OHTXOBOJKVJCQN-OLZOCXBDSA-N |
| XLogP | 1.45 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|