C38H76O5Si2 — CID 56933913
(3S,4S,5S,8R,10S,11S,12E,14S)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-5-methoxy-4,6,6,8,10,12,14,16-octamethylheptadeca-12,15-dien-7-one (PubChem CID 56933913) has the molecular formula C38H76O5Si2 and a molecular weight of 669.19 g/mol. Its IUPAC name is (3S,4S,5S,8R,10S,11S,12E,14S)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-5-methoxy-4,6,6,8,10,12,14,16-octamethylheptadeca-12,15-dien-7-one.
| Compound Name | (3S,4S,5S,8R,10S,11S,12E,14S)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-5-methoxy-4,6,6,8,10,12,14,16-octamethylheptadeca-12,15-dien-7-one |
|---|---|
| PubChem CID | 56933913 |
| Molecular Formula | C38H76O5Si2 |
| Molecular Weight | 669.19 g/mol |
| Exact Mass | 668.52 |
| IUPAC Name | (3S,4S,5S,8R,10S,11S,12E,14S)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-5-methoxy-4,6,6,8,10,12,14,16-octamethylheptadeca-12,15-dien-7-one |
| SMILES | CO[C@@H]([C@H](C)[C@H](CCO)O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)[C@H](C)C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@@H](C)C=C(C)C |
| InChI | InChI=1S/C38H76O5Si2/c1-26(2)23-27(3)24-28(4)33(43-45(19,20)37(11,12)13)29(5)25-30(6)34(40)38(14,15)35(41-16)31(7)32(21-22-39)42-44(17,18)36(8,9)10/h23-24,27,29-33,35,39H,21-22,25H2,1-20H3/b28-24+/t27-,29-,30+,31+,32-,33+,35-/m0/s1 |
| InChIKey | MBAHPRSBYOPLRZ-NECGEPCOSA-N |
| XLogP | 10.61 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.19 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|