C6H7FO3 — CID 56934248
(1R,2S,4R,5S,6R)-5-fluoro-3,8,9-trioxatricyclo[4.2.1.02,4]nonane (PubChem CID 56934248) has the molecular formula C6H7FO3 and a molecular weight of 146.12 g/mol. Its IUPAC name is (1R,2S,4R,5S,6R)-5-fluoro-3,8,9-trioxatricyclo[4.2.1.02,4]nonane.
| Compound Name | (1R,2S,4R,5S,6R)-5-fluoro-3,8,9-trioxatricyclo[4.2.1.02,4]nonane |
|---|---|
| PubChem CID | 56934248 |
| Molecular Formula | C6H7FO3 |
| Molecular Weight | 146.12 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | (1R,2S,4R,5S,6R)-5-fluoro-3,8,9-trioxatricyclo[4.2.1.02,4]nonane |
| SMILES | F[C@@H]1[C@@H]2O[C@@H]2[C@@H]2OC[C@H]1O2 |
| InChI | InChI=1S/C6H7FO3/c7-3-2-1-8-6(9-2)5-4(3)10-5/h2-6H,1H2/t2-,3+,4+,5+,6-/m1/s1 |
| InChIKey | LTWZPBFZFAIUIA-QBFJYBIGSA-N |
| XLogP | -0.15 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.12 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|