C21H14ClFN2O4 — CID 56934291
2-[(3-chloro-4-fluorophenyl)methyl]-7-hydroxy-4-methyl-5-phenylpyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 56934291) has the molecular formula C21H14ClFN2O4 and a molecular weight of 412.80 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methyl]-7-hydroxy-4-methyl-5-phenylpyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methyl]-7-hydroxy-4-methyl-5-phenylpyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 56934291 |
| Molecular Formula | C21H14ClFN2O4 |
| Molecular Weight | 412.80 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methyl]-7-hydroxy-4-methyl-5-phenylpyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Cc1c2c(c(O)c(=O)n1-c1ccccc1)C(=O)N(Cc1ccc(F)c(Cl)c1)C2=O |
| InChI | InChI=1S/C21H14ClFN2O4/c1-11-16-17(18(26)21(29)25(11)13-5-3-2-4-6-13)20(28)24(19(16)27)10-12-7-8-15(23)14(22)9-12/h2-9,26H,10H2,1H3 |
| InChIKey | BODDHOQAJARJEH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.80 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|