C17H22FNO3S — CID 56934433
ethyl 2-[(1R,3E)-3-[(R)-tert-butylsulfinyl]imino-5-fluoro-1,2-dihydroinden-1-yl]acetate (PubChem CID 56934433) has the molecular formula C17H22FNO3S and a molecular weight of 339.43 g/mol. Its IUPAC name is ethyl 2-[(1R,3E)-3-[(R)-tert-butylsulfinyl]imino-5-fluoro-1,2-dihydroinden-1-yl]acetate.
| Compound Name | ethyl 2-[(1R,3E)-3-[(R)-tert-butylsulfinyl]imino-5-fluoro-1,2-dihydroinden-1-yl]acetate |
|---|---|
| PubChem CID | 56934433 |
| Molecular Formula | C17H22FNO3S |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | ethyl 2-[(1R,3E)-3-[(R)-tert-butylsulfinyl]imino-5-fluoro-1,2-dihydroinden-1-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C/C(=N\[S@](=O)C(C)(C)C)c2cc(F)ccc21 |
| InChI | InChI=1S/C17H22FNO3S/c1-5-22-16(20)9-11-8-15(19-23(21)17(2,3)4)14-10-12(18)6-7-13(11)14/h6-7,10-11H,5,8-9H2,1-4H3/b19-15+/t11-,23-/m1/s1 |
| InChIKey | WYTPSSSOKKSODK-LJXWLCIDSA-N |
| XLogP | 3.52 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|