C30H30O2S2 — CID 56934596
2,3-bis[(2,4,6-trimethylphenyl)methylsulfanyl]naphthalene-1,4-dione (PubChem CID 56934596) has the molecular formula C30H30O2S2 and a molecular weight of 486.70 g/mol. Its IUPAC name is 2,3-bis[(2,4,6-trimethylphenyl)methylsulfanyl]naphthalene-1,4-dione.
| Compound Name | 2,3-bis[(2,4,6-trimethylphenyl)methylsulfanyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 56934596 |
| Molecular Formula | C30H30O2S2 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 2,3-bis[(2,4,6-trimethylphenyl)methylsulfanyl]naphthalene-1,4-dione |
| SMILES | Cc1cc(C)c(CSC2=C(SCc3c(C)cc(C)cc3C)C(=O)c3ccccc3C2=O)c(C)c1 |
| InChI | InChI=1S/C30H30O2S2/c1-17-11-19(3)25(20(4)12-17)15-33-29-27(31)23-9-7-8-10-24(23)28(32)30(29)34-16-26-21(5)13-18(2)14-22(26)6/h7-14H,15-16H2,1-6H3 |
| InChIKey | FSCNGDJYVZVVFV-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|