C40H60O5S — CID 56934604
[(1R,2S,5S,10S,14R,15R,17R,21R,23R)-1,2,8,8,15,19,19,22,22-nonamethyl-18,20-dioxahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacos-11-en-5-yl]methyl 4-methylbenzenesulfonate (PubChem CID 56934604) has the molecular formula C40H60O5S and a molecular weight of 652.98 g/mol. Its IUPAC name is [(1R,2S,5S,10S,14R,15R,17R,21R,23R)-1,2,8,8,15,19,19,22,22-nonamethyl-18,20-dioxahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacos-11-en-5-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1R,2S,5S,10S,14R,15R,17R,21R,23R)-1,2,8,8,15,19,19,22,22-nonamethyl-18,20-dioxahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacos-11-en-5-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 56934604 |
| Molecular Formula | C40H60O5S |
| Molecular Weight | 652.98 g/mol |
| Exact Mass | 652.42 |
| IUPAC Name | [(1R,2S,5S,10S,14R,15R,17R,21R,23R)-1,2,8,8,15,19,19,22,22-nonamethyl-18,20-dioxahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacos-11-en-5-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@]23CCC(C)(C)C[C@H]2C2=CC[C@@H]4[C@@]5(C)C[C@H]6OC(C)(C)O[C@@H]6C(C)(C)[C@@H]5CC[C@@]4(C)[C@]2(C)CC3)cc1 |
| InChI | InChI=1S/C40H60O5S/c1-26-11-13-27(14-12-26)46(41,42)43-25-40-21-19-34(2,3)23-29(40)28-15-16-32-37(8)24-30-33(45-36(6,7)44-30)35(4,5)31(37)17-18-39(32,10)38(28,9)20-22-40/h11-15,29-33H,16-25H2,1-10H3/t29-,30+,31-,32+,33-,37-,38+,39+,40+/m0/s1 |
| InChIKey | HZIWWNJPDXXMGC-VAHAEWKHSA-N |
| XLogP | 9.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.98 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|