C21H30O4 — CID 56934889
(1S,8S,9S,10R,11S,13S,14S,17S)-1,7-dideuterio-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 56934889) has the molecular formula C21H30O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is (1S,8S,9S,10R,11S,13S,14S,17S)-1,7-dideuterio-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (1S,8S,9S,10R,11S,13S,14S,17S)-1,7-dideuterio-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 56934889 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (1S,8S,9S,10R,11S,13S,14S,17S)-1,7-dideuterio-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | [2H]C1CC2=[13CH][13C](=O)C[C@H]([2H])[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)CO)[C@@]1(C)C[C@@H]2O |
| InChI | InChI=1S/C21H30O4/c1-20-8-7-13(23)9-12(20)3-4-14-15-5-6-16(18(25)11-22)21(15,2)10-17(24)19(14)20/h9,14-17,19,22,24H,3-8,10-11H2,1-2H3/t14-,15-,16+,17-,19+,20-,21-/m0/s1/i4D,8D,9+1,13+1/t4?,8-,14-,15-,16+,17-,19+,20-,21- |
| InChIKey | OMFXVFTZEKFJBZ-NYOWCZRQSA-N |
| XLogP | 2.67 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |