About methyl 2-[3-(6-bromohexyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetate
methyl 2-[3-(6-bromohexyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetate (PubChem CID 56934962) has the molecular formula C24H27BrN2O4
and a molecular weight of 487.39 g/mol. Its IUPAC name is methyl 2-[3-(6-bromohexyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[3-(6-bromohexyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetate |
| PubChem CID | 56934962 |
| Molecular Formula | C24H27BrN2O4 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | methyl 2-[3-(6-bromohexyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)N(CCCCCCBr)C(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C24H27BrN2O4/c1-31-21(28)18-26-22(29)24(19-12-6-4-7-13-19,20-14-8-5-9-15-20)27(23(26)30)17-11-3-2-10-16-25/h4-9,12-15H,2-3,10-11,16-18H2,1H3 |
| InChIKey | ALZMPTOTEXXNMF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[3-(6-bromohexyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-(6-bromohexyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetate?
The IUPAC name of methyl 2-[3-(6-bromohexyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetate (CID 56934962) is methyl 2-[3-(6-bromohexyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetate.
What is the SMILES notation for methyl 2-[3-(6-bromohexyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetate?
The canonical SMILES for methyl 2-[3-(6-bromohexyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetate is COC(=O)CN1C(=O)N(CCCCCCBr)C(c2ccccc2)(c2ccccc2)C1=O.
What is the InChIKey of methyl 2-[3-(6-bromohexyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetate?
The InChIKey is ALZMPTOTEXXNMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27BrN2O4/c1-31-21(28)18-26-22(29)24(19-12-6-4-7-13-19,20-14-8-5-9-15-20)27(23(26)30)17-11-3-2-10-16-25/h4-9,12-15H,2-3,10-11,16-18H2,1H3.
What are the key properties of methyl 2-[3-(6-bromohexyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetate?
methyl 2-[3-(6-bromohexyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetate has a molecular weight of 487.39 g/mol, XLogP of 4.32, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(6-bromohexyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetate is sourced from PubChem (CID 56934962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).