C24H27BrN2O4 — CID 56934962
methyl 2-[3-(6-bromohexyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetate (PubChem CID 56934962) has the molecular formula C24H27BrN2O4 and a molecular weight of 487.39 g/mol. Its IUPAC name is methyl 2-[3-(6-bromohexyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[3-(6-bromohexyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 56934962 |
| Molecular Formula | C24H27BrN2O4 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | methyl 2-[3-(6-bromohexyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)N(CCCCCCBr)C(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C24H27BrN2O4/c1-31-21(28)18-26-22(29)24(19-12-6-4-7-13-19,20-14-8-5-9-15-20)27(23(26)30)17-11-3-2-10-16-25/h4-9,12-15H,2-3,10-11,16-18H2,1H3 |
| InChIKey | ALZMPTOTEXXNMF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|