(E,6R)-2,6-dimethyloct-2-enedioic acid

C10H16O4 — CID 56935840

IUPAC(E,6R)-2,6-dimethyloct-2-enedioic acid
SMILESC/C(=C\CC[C@@H](C)CC(=O)O)C(=O)O
InChIInChI=1S/C10H16O4/c1-7(6-9(11)12)4-3-5-8(2)10(13)14/h5,7H,3-4,6H2,1-2H3,(H,11,12)(H,13,14)/b8-5+/t7-/m1/s1
InChIKeyKWIQWVWDQRSGSQ-KBUNYLKBSA-N
MW200.23 g/mol
LogP1.91
Rot. Bonds6

About (E,6R)-2,6-dimethyloct-2-enedioic acid

(E,6R)-2,6-dimethyloct-2-enedioic acid (PubChem CID 56935840) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (E,6R)-2,6-dimethyloct-2-enedioic acid.

Molecular Properties

Compound Name(E,6R)-2,6-dimethyloct-2-enedioic acid
PubChem CID56935840
Molecular FormulaC10H16O4
Molecular Weight200.23 g/mol
Exact Mass200.10
IUPAC Name(E,6R)-2,6-dimethyloct-2-enedioic acid
SMILESC/C(=C\CC[C@@H](C)CC(=O)O)C(=O)O
InChIInChI=1S/C10H16O4/c1-7(6-9(11)12)4-3-5-8(2)10(13)14/h5,7H,3-4,6H2,1-2H3,(H,11,12)(H,13,14)/b8-5+/t7-/m1/s1
InChIKeyKWIQWVWDQRSGSQ-KBUNYLKBSA-N
XLogP1.91
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.23
LogP ≤ 51.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E,6R)-2,6-dimethyloct-2-enedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E,6R)-2,6-dimethyloct-2-enedioic acid?
The IUPAC name of (E,6R)-2,6-dimethyloct-2-enedioic acid (CID 56935840) is (E,6R)-2,6-dimethyloct-2-enedioic acid.
What is the SMILES notation for (E,6R)-2,6-dimethyloct-2-enedioic acid?
The canonical SMILES for (E,6R)-2,6-dimethyloct-2-enedioic acid is C/C(=C\CC[C@@H](C)CC(=O)O)C(=O)O.
What is the InChIKey of (E,6R)-2,6-dimethyloct-2-enedioic acid?
The InChIKey is KWIQWVWDQRSGSQ-KBUNYLKBSA-N. The full InChI is InChI=1S/C10H16O4/c1-7(6-9(11)12)4-3-5-8(2)10(13)14/h5,7H,3-4,6H2,1-2H3,(H,11,12)(H,13,14)/b8-5+/t7-/m1/s1.
What are the key properties of (E,6R)-2,6-dimethyloct-2-enedioic acid?
(E,6R)-2,6-dimethyloct-2-enedioic acid has a molecular weight of 200.23 g/mol, XLogP of 1.91, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E,6R)-2,6-dimethyloct-2-enedioic acid is sourced from PubChem (CID 56935840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).