C21H40O — CID 56935898
(6Z,9Z,11R)-henicosa-6,9-dien-11-ol (PubChem CID 56935898) has the molecular formula C21H40O and a molecular weight of 308.55 g/mol. Its IUPAC name is (6Z,9Z,11R)-henicosa-6,9-dien-11-ol.
| Compound Name | (6Z,9Z,11R)-henicosa-6,9-dien-11-ol |
|---|---|
| PubChem CID | 56935898 |
| Molecular Formula | C21H40O |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.31 |
| IUPAC Name | (6Z,9Z,11R)-henicosa-6,9-dien-11-ol |
| SMILES | CCCCC/C=C\C/C=C\[C@H](O)CCCCCCCCCC |
| InChI | InChI=1S/C21H40O/c1-3-5-7-9-11-13-15-17-19-21(22)20-18-16-14-12-10-8-6-4-2/h11,13,17,19,21-22H,3-10,12,14-16,18,20H2,1-2H3/b13-11-,19-17-/t21-/m0/s1 |
| InChIKey | DMDZJDJIGNDJQK-PISUKDBQSA-N |
| XLogP | 6.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|