About [(E)-2-methylbut-2-enyl] butanoate
[(E)-2-methylbut-2-enyl] butanoate (PubChem CID 56936000) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is [(E)-2-methylbut-2-enyl] butanoate.
Molecular Properties
| Compound Name | [(E)-2-methylbut-2-enyl] butanoate |
| PubChem CID | 56936000 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | [(E)-2-methylbut-2-enyl] butanoate |
| SMILES | C/C=C(\C)COC(=O)CCC |
| InChI | InChI=1S/C9H16O2/c1-4-6-9(10)11-7-8(3)5-2/h5H,4,6-7H2,1-3H3/b8-5+ |
| InChIKey | JLVXNEUMPJYPPE-VMPITWQZSA-N |
| XLogP | 2.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-2-methylbut-2-enyl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-methylbut-2-enyl] butanoate?
The IUPAC name of [(E)-2-methylbut-2-enyl] butanoate (CID 56936000) is [(E)-2-methylbut-2-enyl] butanoate.
What is the SMILES notation for [(E)-2-methylbut-2-enyl] butanoate?
The canonical SMILES for [(E)-2-methylbut-2-enyl] butanoate is C/C=C(\C)COC(=O)CCC.
What is the InChIKey of [(E)-2-methylbut-2-enyl] butanoate?
The InChIKey is JLVXNEUMPJYPPE-VMPITWQZSA-N. The full InChI is InChI=1S/C9H16O2/c1-4-6-9(10)11-7-8(3)5-2/h5H,4,6-7H2,1-3H3/b8-5+.
What are the key properties of [(E)-2-methylbut-2-enyl] butanoate?
[(E)-2-methylbut-2-enyl] butanoate has a molecular weight of 156.22 g/mol, XLogP of 2.30, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-methylbut-2-enyl] butanoate is sourced from PubChem (CID 56936000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).