About [(E)-hex-2-enyl] (Z)-hex-3-enoate
[(E)-hex-2-enyl] (Z)-hex-3-enoate (PubChem CID 56936003) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is [(E)-hex-2-enyl] (Z)-hex-3-enoate.
Molecular Properties
| Compound Name | [(E)-hex-2-enyl] (Z)-hex-3-enoate |
| PubChem CID | 56936003 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | [(E)-hex-2-enyl] (Z)-hex-3-enoate |
| SMILES | CC/C=C\CC(=O)OC/C=C/CCC |
| InChI | InChI=1S/C12H20O2/c1-3-5-7-9-11-14-12(13)10-8-6-4-2/h6-9H,3-5,10-11H2,1-2H3/b8-6-,9-7+ |
| InChIKey | JNQWJWVBGRTRTA-MKKAVFGOSA-N |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-hex-2-enyl] (Z)-hex-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-hex-2-enyl] (Z)-hex-3-enoate?
The IUPAC name of [(E)-hex-2-enyl] (Z)-hex-3-enoate (CID 56936003) is [(E)-hex-2-enyl] (Z)-hex-3-enoate.
What is the SMILES notation for [(E)-hex-2-enyl] (Z)-hex-3-enoate?
The canonical SMILES for [(E)-hex-2-enyl] (Z)-hex-3-enoate is CC/C=C\CC(=O)OC/C=C/CCC.
What is the InChIKey of [(E)-hex-2-enyl] (Z)-hex-3-enoate?
The InChIKey is JNQWJWVBGRTRTA-MKKAVFGOSA-N. The full InChI is InChI=1S/C12H20O2/c1-3-5-7-9-11-14-12(13)10-8-6-4-2/h6-9H,3-5,10-11H2,1-2H3/b8-6-,9-7+.
What are the key properties of [(E)-hex-2-enyl] (Z)-hex-3-enoate?
[(E)-hex-2-enyl] (Z)-hex-3-enoate has a molecular weight of 196.29 g/mol, XLogP of 3.24, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-hex-2-enyl] (Z)-hex-3-enoate is sourced from PubChem (CID 56936003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).