About 3,7-dimethyloct-6-enyl 3,7-dimethyloctanoate
3,7-dimethyloct-6-enyl 3,7-dimethyloctanoate (PubChem CID 56936011) has the molecular formula C20H38O2
and a molecular weight of 310.52 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl 3,7-dimethyloctanoate.
Molecular Properties
| Compound Name | 3,7-dimethyloct-6-enyl 3,7-dimethyloctanoate |
| PubChem CID | 56936011 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | 3,7-dimethyloct-6-enyl 3,7-dimethyloctanoate |
| SMILES | CC(C)=CCCC(C)CCOC(=O)CC(C)CCCC(C)C |
| InChI | InChI=1S/C20H38O2/c1-16(2)9-7-11-18(5)13-14-22-20(21)15-19(6)12-8-10-17(3)4/h9,17-19H,7-8,10-15H2,1-6H3 |
| InChIKey | BKDMRKWDXFGRBC-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyloct-6-enyl 3,7-dimethyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyloct-6-enyl 3,7-dimethyloctanoate?
The IUPAC name of 3,7-dimethyloct-6-enyl 3,7-dimethyloctanoate (CID 56936011) is 3,7-dimethyloct-6-enyl 3,7-dimethyloctanoate.
What is the SMILES notation for 3,7-dimethyloct-6-enyl 3,7-dimethyloctanoate?
The canonical SMILES for 3,7-dimethyloct-6-enyl 3,7-dimethyloctanoate is CC(C)=CCCC(C)CCOC(=O)CC(C)CCCC(C)C.
What is the InChIKey of 3,7-dimethyloct-6-enyl 3,7-dimethyloctanoate?
The InChIKey is BKDMRKWDXFGRBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O2/c1-16(2)9-7-11-18(5)13-14-22-20(21)15-19(6)12-8-10-17(3)4/h9,17-19H,7-8,10-15H2,1-6H3.
What are the key properties of 3,7-dimethyloct-6-enyl 3,7-dimethyloctanoate?
3,7-dimethyloct-6-enyl 3,7-dimethyloctanoate has a molecular weight of 310.52 g/mol, XLogP of 6.15, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyloct-6-enyl 3,7-dimethyloctanoate is sourced from PubChem (CID 56936011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).