About [(2Z)-3,7-dimethylocta-2,6-dienyl] decanoate
[(2Z)-3,7-dimethylocta-2,6-dienyl] decanoate (PubChem CID 56936013) has the molecular formula C20H36O2
and a molecular weight of 308.51 g/mol. Its IUPAC name is [(2Z)-3,7-dimethylocta-2,6-dienyl] decanoate.
Molecular Properties
| Compound Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] decanoate |
| PubChem CID | 56936013 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C20H36O2/c1-5-6-7-8-9-10-11-15-20(21)22-17-16-19(4)14-12-13-18(2)3/h13,16H,5-12,14-15,17H2,1-4H3/b19-16- |
| InChIKey | ICAWXCQTUNYABR-MNDPQUGUSA-N |
| XLogP | 6.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-3,7-dimethylocta-2,6-dienyl] decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-3,7-dimethylocta-2,6-dienyl] decanoate?
The IUPAC name of [(2Z)-3,7-dimethylocta-2,6-dienyl] decanoate (CID 56936013) is [(2Z)-3,7-dimethylocta-2,6-dienyl] decanoate.
What is the SMILES notation for [(2Z)-3,7-dimethylocta-2,6-dienyl] decanoate?
The canonical SMILES for [(2Z)-3,7-dimethylocta-2,6-dienyl] decanoate is CCCCCCCCCC(=O)OC/C=C(/C)CCC=C(C)C.
What is the InChIKey of [(2Z)-3,7-dimethylocta-2,6-dienyl] decanoate?
The InChIKey is ICAWXCQTUNYABR-MNDPQUGUSA-N. The full InChI is InChI=1S/C20H36O2/c1-5-6-7-8-9-10-11-15-20(21)22-17-16-19(4)14-12-13-18(2)3/h13,16H,5-12,14-15,17H2,1-4H3/b19-16-.
What are the key properties of [(2Z)-3,7-dimethylocta-2,6-dienyl] decanoate?
[(2Z)-3,7-dimethylocta-2,6-dienyl] decanoate has a molecular weight of 308.51 g/mol, XLogP of 6.36, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-3,7-dimethylocta-2,6-dienyl] decanoate is sourced from PubChem (CID 56936013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).