About 4-methylheptan-3-yl (Z)-octadec-9-enoate
4-methylheptan-3-yl (Z)-octadec-9-enoate (PubChem CID 56936030) has the molecular formula C26H50O2
and a molecular weight of 394.68 g/mol. Its IUPAC name is 4-methylheptan-3-yl (Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | 4-methylheptan-3-yl (Z)-octadec-9-enoate |
| PubChem CID | 56936030 |
| Molecular Formula | C26H50O2 |
| Molecular Weight | 394.68 g/mol |
| Exact Mass | 394.38 |
| IUPAC Name | 4-methylheptan-3-yl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(CC)C(C)CCC |
| InChI | InChI=1S/C26H50O2/c1-5-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-26(27)28-25(7-3)24(4)22-6-2/h14-15,24-25H,5-13,16-23H2,1-4H3/b15-14- |
| InChIKey | JNAHKRYBYLASGC-PFONDFGASA-N |
| XLogP | 8.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.68 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methylheptan-3-yl (Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylheptan-3-yl (Z)-octadec-9-enoate?
The IUPAC name of 4-methylheptan-3-yl (Z)-octadec-9-enoate (CID 56936030) is 4-methylheptan-3-yl (Z)-octadec-9-enoate.
What is the SMILES notation for 4-methylheptan-3-yl (Z)-octadec-9-enoate?
The canonical SMILES for 4-methylheptan-3-yl (Z)-octadec-9-enoate is CCCCCCCC/C=C\CCCCCCCC(=O)OC(CC)C(C)CCC.
What is the InChIKey of 4-methylheptan-3-yl (Z)-octadec-9-enoate?
The InChIKey is JNAHKRYBYLASGC-PFONDFGASA-N. The full InChI is InChI=1S/C26H50O2/c1-5-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-26(27)28-25(7-3)24(4)22-6-2/h14-15,24-25H,5-13,16-23H2,1-4H3/b15-14-.
What are the key properties of 4-methylheptan-3-yl (Z)-octadec-9-enoate?
4-methylheptan-3-yl (Z)-octadec-9-enoate has a molecular weight of 394.68 g/mol, XLogP of 8.78, 20 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylheptan-3-yl (Z)-octadec-9-enoate is sourced from PubChem (CID 56936030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).