C14H22O2 — CID 56936048
(6Z,9Z,14R)-14-methyl-1-oxacyclotetradeca-6,9-dien-2-one (PubChem CID 56936048) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (6Z,9Z,14R)-14-methyl-1-oxacyclotetradeca-6,9-dien-2-one.
| Compound Name | (6Z,9Z,14R)-14-methyl-1-oxacyclotetradeca-6,9-dien-2-one |
|---|---|
| PubChem CID | 56936048 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (6Z,9Z,14R)-14-methyl-1-oxacyclotetradeca-6,9-dien-2-one |
| SMILES | C[C@@H]1CCC/C=C\C/C=C\CCCC(=O)O1 |
| InChI | InChI=1S/C14H22O2/c1-13-11-9-7-5-3-2-4-6-8-10-12-14(15)16-13/h3-6,13H,2,7-12H2,1H3/b5-3-,6-4-/t13-/m1/s1 |
| InChIKey | JSZKXZJGTWVDOI-LPFHBXDTSA-N |
| XLogP | 3.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|