C13H22 — CID 56936065
(3E,5E,7E)-6-ethyl-4-methyldeca-3,5,7-triene (PubChem CID 56936065) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is (3E,5E,7E)-6-ethyl-4-methyldeca-3,5,7-triene.
| Compound Name | (3E,5E,7E)-6-ethyl-4-methyldeca-3,5,7-triene |
|---|---|
| PubChem CID | 56936065 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | (3E,5E,7E)-6-ethyl-4-methyldeca-3,5,7-triene |
| SMILES | CC/C=C/C(=C/C(C)=C/CC)CC |
| InChI | InChI=1S/C13H22/c1-5-8-10-13(7-3)11-12(4)9-6-2/h8-11H,5-7H2,1-4H3/b10-8+,12-9+,13-11+ |
| InChIKey | XVFSRVJYTDFHHZ-GCMZYXHCSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|