About (7Z,9E)-2-methyloctadeca-7,9-diene
(7Z,9E)-2-methyloctadeca-7,9-diene (PubChem CID 56936099) has the molecular formula C19H36
and a molecular weight of 264.50 g/mol. Its IUPAC name is (7Z,9E)-2-methyloctadeca-7,9-diene.
Molecular Properties
| Compound Name | (7Z,9E)-2-methyloctadeca-7,9-diene |
| PubChem CID | 56936099 |
| Molecular Formula | C19H36 |
| Molecular Weight | 264.50 g/mol |
| Exact Mass | 264.28 |
| IUPAC Name | (7Z,9E)-2-methyloctadeca-7,9-diene |
| SMILES | CCCCCCCC/C=C/C=C\CCCCC(C)C |
| InChI | InChI=1S/C19H36/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3/h11-14,19H,4-10,15-18H2,1-3H3/b12-11+,14-13- |
| InChIKey | RFMGIWIKGFYQFJ-WCYNZMGESA-N |
| XLogP | 7.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.50 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (7Z,9E)-2-methyloctadeca-7,9-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7Z,9E)-2-methyloctadeca-7,9-diene?
The IUPAC name of (7Z,9E)-2-methyloctadeca-7,9-diene (CID 56936099) is (7Z,9E)-2-methyloctadeca-7,9-diene.
What is the SMILES notation for (7Z,9E)-2-methyloctadeca-7,9-diene?
The canonical SMILES for (7Z,9E)-2-methyloctadeca-7,9-diene is CCCCCCCC/C=C/C=C\CCCCC(C)C.
What is the InChIKey of (7Z,9E)-2-methyloctadeca-7,9-diene?
The InChIKey is RFMGIWIKGFYQFJ-WCYNZMGESA-N. The full InChI is InChI=1S/C19H36/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3/h11-14,19H,4-10,15-18H2,1-3H3/b12-11+,14-13-.
What are the key properties of (7Z,9E)-2-methyloctadeca-7,9-diene?
(7Z,9E)-2-methyloctadeca-7,9-diene has a molecular weight of 264.50 g/mol, XLogP of 7.07, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (7Z,9E)-2-methyloctadeca-7,9-diene is sourced from PubChem (CID 56936099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).