About 3,4-dimethylheptan-2-one
3,4-dimethylheptan-2-one (PubChem CID 56936213) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is 3,4-dimethylheptan-2-one.
Molecular Properties
| Compound Name | 3,4-dimethylheptan-2-one |
| PubChem CID | 56936213 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 3,4-dimethylheptan-2-one |
| SMILES | CCCC(C)C(C)C(C)=O |
| InChI | InChI=1S/C9H18O/c1-5-6-7(2)8(3)9(4)10/h7-8H,5-6H2,1-4H3 |
| InChIKey | HLPAYTLTGGTXHJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dimethylheptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethylheptan-2-one?
The IUPAC name of 3,4-dimethylheptan-2-one (CID 56936213) is 3,4-dimethylheptan-2-one.
What is the SMILES notation for 3,4-dimethylheptan-2-one?
The canonical SMILES for 3,4-dimethylheptan-2-one is CCCC(C)C(C)C(C)=O.
What is the InChIKey of 3,4-dimethylheptan-2-one?
The InChIKey is HLPAYTLTGGTXHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O/c1-5-6-7(2)8(3)9(4)10/h7-8H,5-6H2,1-4H3.
What are the key properties of 3,4-dimethylheptan-2-one?
3,4-dimethylheptan-2-one has a molecular weight of 142.24 g/mol, XLogP of 2.65, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethylheptan-2-one is sourced from PubChem (CID 56936213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).