About (7E,9E)-6-hydroxyhenicosa-7,9-dien-11-one
(7E,9E)-6-hydroxyhenicosa-7,9-dien-11-one (PubChem CID 56936229) has the molecular formula C21H38O2
and a molecular weight of 322.53 g/mol. Its IUPAC name is (7E,9E)-6-hydroxyhenicosa-7,9-dien-11-one.
Molecular Properties
| Compound Name | (7E,9E)-6-hydroxyhenicosa-7,9-dien-11-one |
| PubChem CID | 56936229 |
| Molecular Formula | C21H38O2 |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 322.29 |
| IUPAC Name | (7E,9E)-6-hydroxyhenicosa-7,9-dien-11-one |
| SMILES | CCCCCCCCCCC(=O)/C=C/C=C/C(O)CCCCC |
| InChI | InChI=1S/C21H38O2/c1-3-5-7-8-9-10-11-13-17-21(23)19-15-14-18-20(22)16-12-6-4-2/h14-15,18-20,22H,3-13,16-17H2,1-2H3/b18-14+,19-15+ |
| InChIKey | YVHOHNBOYSRAMU-JSAVKQRWSA-N |
| XLogP | 6.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (7E,9E)-6-hydroxyhenicosa-7,9-dien-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7E,9E)-6-hydroxyhenicosa-7,9-dien-11-one?
The IUPAC name of (7E,9E)-6-hydroxyhenicosa-7,9-dien-11-one (CID 56936229) is (7E,9E)-6-hydroxyhenicosa-7,9-dien-11-one.
What is the SMILES notation for (7E,9E)-6-hydroxyhenicosa-7,9-dien-11-one?
The canonical SMILES for (7E,9E)-6-hydroxyhenicosa-7,9-dien-11-one is CCCCCCCCCCC(=O)/C=C/C=C/C(O)CCCCC.
What is the InChIKey of (7E,9E)-6-hydroxyhenicosa-7,9-dien-11-one?
The InChIKey is YVHOHNBOYSRAMU-JSAVKQRWSA-N. The full InChI is InChI=1S/C21H38O2/c1-3-5-7-8-9-10-11-13-17-21(23)19-15-14-18-20(22)16-12-6-4-2/h14-15,18-20,22H,3-13,16-17H2,1-2H3/b18-14+,19-15+.
What are the key properties of (7E,9E)-6-hydroxyhenicosa-7,9-dien-11-one?
(7E,9E)-6-hydroxyhenicosa-7,9-dien-11-one has a molecular weight of 322.53 g/mol, XLogP of 6.14, 16 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7E,9E)-6-hydroxyhenicosa-7,9-dien-11-one is sourced from PubChem (CID 56936229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).