C33H36ClN5O3 — CID 56941081
3-[1-[acetyl(benzyl)amino]-2-(cyclohexylamino)-2-oxoethyl]-6-chloro-N-(2-pyridin-4-ylethyl)-1H-indole-2-carboxamide (PubChem CID 56941081) has the molecular formula C33H36ClN5O3 and a molecular weight of 586.14 g/mol. Its IUPAC name is 3-[1-[acetyl(benzyl)amino]-2-(cyclohexylamino)-2-oxoethyl]-6-chloro-N-(2-pyridin-4-ylethyl)-1H-indole-2-carboxamide.
| Compound Name | 3-[1-[acetyl(benzyl)amino]-2-(cyclohexylamino)-2-oxoethyl]-6-chloro-N-(2-pyridin-4-ylethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 56941081 |
| Molecular Formula | C33H36ClN5O3 |
| Molecular Weight | 586.14 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | 3-[1-[acetyl(benzyl)amino]-2-(cyclohexylamino)-2-oxoethyl]-6-chloro-N-(2-pyridin-4-ylethyl)-1H-indole-2-carboxamide |
| SMILES | CC(=O)N(Cc1ccccc1)C(C(=O)NC1CCCCC1)c1c(C(=O)NCCc2ccncc2)[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C33H36ClN5O3/c1-22(40)39(21-24-8-4-2-5-9-24)31(33(42)37-26-10-6-3-7-11-26)29-27-13-12-25(34)20-28(27)38-30(29)32(41)36-19-16-23-14-17-35-18-15-23/h2,4-5,8-9,12-15,17-18,20,26,31,38H,3,6-7,10-11,16,19,21H2,1H3,(H,36,41)(H,37,42) |
| InChIKey | NUDOFPZNMCFUGO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.14 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|