About Brilanestrant
Brilanestrant (PubChem CID 56941241) has the molecular formula C26H20ClFN2O2
and a molecular weight of 446.90 g/mol. Its IUPAC name is (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid.
Molecular Properties
| Compound Name | Brilanestrant |
| PubChem CID | 56941241 |
| Molecular Formula | C26H20ClFN2O2 |
| Molecular Weight | 446.90 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CC/C(=C(/C1=CC=C(C=C1)/C=C/C(=O)O)\C2=CC3=C(C=C2)NN=C3)/C4=C(C=C(C=C4)F)Cl |
| InChI | InChI=1S/C26H20ClFN2O2/c1-2-21(22-10-9-20(28)14-23(22)27)26(18-8-11-24-19(13-18)15-29-30-24)17-6-3-16(4-7-17)5-12-25(31)32/h3-15H,2H2,1H3,(H,29,30)(H,31,32)/b12-5+,26-21+ |
| InChIKey | BURHGPHDEVGCEZ-KJGLQBJMSA-N |
| XLogP | 7.40 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | 719 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.90 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze Brilanestrant with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Brilanestrant?
The IUPAC name of Brilanestrant (CID 56941241) is (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid.
What is the SMILES notation for Brilanestrant?
The canonical SMILES for Brilanestrant is CC/C(=C(/C1=CC=C(C=C1)/C=C/C(=O)O)\C2=CC3=C(C=C2)NN=C3)/C4=C(C=C(C=C4)F)Cl.
What is the InChIKey of Brilanestrant?
The InChIKey is BURHGPHDEVGCEZ-KJGLQBJMSA-N. The full InChI is InChI=1S/C26H20ClFN2O2/c1-2-21(22-10-9-20(28)14-23(22)27)26(18-8-11-24-19(13-18)15-29-30-24)17-6-3-16(4-7-17)5-12-25(31)32/h3-15H,2H2,1H3,(H,29,30)(H,31,32)/b12-5+,26-21+.
What are the key properties of Brilanestrant?
Brilanestrant has a molecular weight of 446.90 g/mol, XLogP of 7.40, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Brilanestrant is sourced from PubChem (CID 56941241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).